C19H30N2O6S — CID 30599544
N-(3-butoxypropyl)-2-[3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl(methyl)amino]acetamide (PubChem CID 30599544) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl(methyl)amino]acetamide.
| Compound Name | N-(3-butoxypropyl)-2-[3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 30599544 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-(3-butoxypropyl)-2-[3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl(methyl)amino]acetamide |
| SMILES | CCCCOCCCNC(=O)CN(C)S(=O)(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H30N2O6S/c1-3-4-10-25-11-5-9-20-19(22)15-21(2)28(23,24)16-7-8-17-18(14-16)27-13-6-12-26-17/h7-8,14H,3-6,9-13,15H2,1-2H3,(H,20,22) |
| InChIKey | CCMUFNAIDRHAAC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|