C11H19ClN2S — CID 3059964
N-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 3059964) has the molecular formula C11H19ClN2S and a molecular weight of 246.81 g/mol. Its IUPAC name is N-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | N-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3059964 |
| Molecular Formula | C11H19ClN2S |
| Molecular Weight | 246.81 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(4,5,6,7-tetrahydro-1,3-benzothiazol-6-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | CCCNCC1CCc2ncsc2C1.Cl |
| InChI | InChI=1S/C11H18N2S.ClH/c1-2-5-12-7-9-3-4-10-11(6-9)14-8-13-10;/h8-9,12H,2-7H2,1H3;1H |
| InChIKey | HTYBZKNDZXVOAI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|