C13H23ClN2S — CID 3059984
N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methyl]butan-1-amine;hydrochloride (PubChem CID 3059984) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3059984 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl)methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCC1CCc2sc(C)nc2C1.Cl |
| InChI | InChI=1S/C13H22N2S.ClH/c1-3-4-7-14-9-11-5-6-13-12(8-11)15-10(2)16-13;/h11,14H,3-9H2,1-2H3;1H |
| InChIKey | GMPRXTHMRXQVLC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|