About 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride
3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride (PubChem CID 3060076) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride |
| PubChem CID | 3060076 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride |
| SMILES | CC1(C)CC(NCc2ccccc2)C(=O)O1.Cl |
| InChI | InChI=1S/C13H17NO2.ClH/c1-13(2)8-11(12(15)16-13)14-9-10-6-4-3-5-7-10;/h3-7,11,14H,8-9H2,1-2H3;1H |
| InChIKey | KTGZBTRGGJDOLE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride?
The IUPAC name of 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride (CID 3060076) is 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride.
What is the SMILES notation for 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride?
The canonical SMILES for 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride is CC1(C)CC(NCc2ccccc2)C(=O)O1.Cl.
What is the InChIKey of 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride?
The InChIKey is KTGZBTRGGJDOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.ClH/c1-13(2)8-11(12(15)16-13)14-9-10-6-4-3-5-7-10;/h3-7,11,14H,8-9H2,1-2H3;1H.
What are the key properties of 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride?
3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride has a molecular weight of 255.75 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)-5,5-dimethyloxolan-2-one;hydrochloride is sourced from PubChem (CID 3060076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).