C26H26N4O4 — CID 3060116
2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 3060116) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 3060116 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2,6-bis(4-pyrrolidin-1-ylbut-2-ynyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(CC#CCN4CCCC4)c(=O)c3cc2c(=O)n1CC#CCN1CCCC1 |
| InChI | InChI=1S/C26H26N4O4/c31-23-19-17-21-22(26(34)30(25(21)33)16-8-6-14-28-11-3-4-12-28)18-20(19)24(32)29(23)15-7-5-13-27-9-1-2-10-27/h17-18H,1-4,9-16H2 |
| InChIKey | YRZMBHQQRUEKRQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|