C30H34N4O4 — CID 3060117
2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 3060117) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 3060117 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 2,6-bis[4-(azepan-1-yl)but-2-ynyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(CC#CCN4CCCCCC4)c(=O)c3cc2c(=O)n1CC#CCN1CCCCCC1 |
| InChI | InChI=1S/C30H34N4O4/c35-27-23-21-25-26(30(38)34(29(25)37)20-12-10-18-32-15-7-3-4-8-16-32)22-24(23)28(36)33(27)19-11-9-17-31-13-5-1-2-6-14-31/h21-22H,1-8,13-20H2 |
| InChIKey | INOQIRVUXKPPQH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|