About methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate
methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate (PubChem CID 3060253) has the molecular formula C24H23N5O4
and a molecular weight of 445.48 g/mol. Its IUPAC name is methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate |
| PubChem CID | 3060253 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCN(Cc3ccc(Nc4ncccn4)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C24H23N5O4/c1-33-23(32)19-7-3-17(4-8-19)15-28-13-14-29(22(31)21(28)30)16-18-5-9-20(10-6-18)27-24-25-11-2-12-26-24/h2-12H,13-16H2,1H3,(H,25,26,27) |
| InChIKey | HLKVCYLOIPGPJV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate?
The IUPAC name of methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate (CID 3060253) is methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate.
What is the SMILES notation for methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate?
The canonical SMILES for methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate is COC(=O)c1ccc(CN2CCN(Cc3ccc(Nc4ncccn4)cc3)C(=O)C2=O)cc1.
What is the InChIKey of methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate?
The InChIKey is HLKVCYLOIPGPJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N5O4/c1-33-23(32)19-7-3-17(4-8-19)15-28-13-14-29(22(31)21(28)30)16-18-5-9-20(10-6-18)27-24-25-11-2-12-26-24/h2-12H,13-16H2,1H3,(H,25,26,27).
What are the key properties of methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate?
methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate has a molecular weight of 445.48 g/mol, XLogP of 2.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2,3-dioxo-4-[[4-(pyrimidin-2-ylamino)phenyl]methyl]piperazin-1-yl]methyl]benzoate is sourced from PubChem (CID 3060253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).