About 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide
1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide (PubChem CID 30603353) has the molecular formula C14H23F3N2O3S
and a molecular weight of 356.41 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
| PubChem CID | 30603353 |
| Molecular Formula | C14H23F3N2O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N[C@H]2CCCC[C@@H]2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H23F3N2O3S/c1-23(21,22)19-8-6-10(7-9-19)13(20)18-12-5-3-2-4-11(12)14(15,16)17/h10-12H,2-9H2,1H3,(H,18,20)/t11-,12-/m0/s1 |
| InChIKey | KJYUUBMOPNNIFC-RYUDHWBXSA-N |
| XLogP | 1.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide?
The IUPAC name of 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide (CID 30603353) is 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide?
The canonical SMILES for 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide is CS(=O)(=O)N1CCC(C(=O)N[C@H]2CCCC[C@@H]2C(F)(F)F)CC1.
What is the InChIKey of 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide?
The InChIKey is KJYUUBMOPNNIFC-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H23F3N2O3S/c1-23(21,22)19-8-6-10(7-9-19)13(20)18-12-5-3-2-4-11(12)14(15,16)17/h10-12H,2-9H2,1H3,(H,18,20)/t11-,12-/m0/s1.
What are the key properties of 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide?
1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide has a molecular weight of 356.41 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-N-[(1S,2S)-2-(trifluoromethyl)cyclohexyl]piperidine-4-carboxamide is sourced from PubChem (CID 30603353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).