About N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine
N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine (PubChem CID 3060382) has the molecular formula C16H17ClN2S
and a molecular weight of 304.85 g/mol. Its IUPAC name is N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine |
| PubChem CID | 3060382 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine |
| SMILES | NCCNC1Cc2cc(Cl)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C16H17ClN2S/c17-12-5-6-15-11(9-12)10-14(19-8-7-18)13-3-1-2-4-16(13)20-15/h1-6,9,14,19H,7-8,10,18H2 |
| InChIKey | ROIOCVOHLCYZNB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_676_A(10)', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine?
The IUPAC name of N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine (CID 3060382) is N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine is NCCNC1Cc2cc(Cl)ccc2Sc2ccccc21.
What is the InChIKey of N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine?
The InChIKey is ROIOCVOHLCYZNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2S/c17-12-5-6-15-11(9-12)10-14(19-8-7-18)13-3-1-2-4-16(13)20-15/h1-6,9,14,19H,7-8,10,18H2.
What are the key properties of N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine?
N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine has a molecular weight of 304.85 g/mol, XLogP of 3.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 3060382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).