About 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride
3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride (PubChem CID 3060415) has the molecular formula C21H28ClNO
and a molecular weight of 345.91 g/mol. Its IUPAC name is 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride |
| PubChem CID | 3060415 |
| Molecular Formula | C21H28ClNO |
| Molecular Weight | 345.91 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride |
| SMILES | CC(CNC1CCCC1)C(O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H27NO.ClH/c1-17(16-22-20-14-8-9-15-20)21(23,18-10-4-2-5-11-18)19-12-6-3-7-13-19;/h2-7,10-13,17,20,22-23H,8-9,14-16H2,1H3;1H |
| InChIKey | GDIWWGYZBONIFY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride?
The IUPAC name of 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride (CID 3060415) is 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride.
What is the SMILES notation for 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride?
The canonical SMILES for 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride is CC(CNC1CCCC1)C(O)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride?
The InChIKey is GDIWWGYZBONIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO.ClH/c1-17(16-22-20-14-8-9-15-20)21(23,18-10-4-2-5-11-18)19-12-6-3-7-13-19;/h2-7,10-13,17,20,22-23H,8-9,14-16H2,1H3;1H.
What are the key properties of 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride?
3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride has a molecular weight of 345.91 g/mol, XLogP of 4.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentylamino)-2-methyl-1,1-diphenylpropan-1-ol;hydrochloride is sourced from PubChem (CID 3060415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).