About 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine
6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine (PubChem CID 3060450) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine.
Molecular Properties
| Compound Name | 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine |
| PubChem CID | 3060450 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine |
| SMILES | c1ccc(C2=NCc3n[nH]nc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C16H12N4/c1-2-6-11(7-3-1)15-12-8-4-5-9-13(12)16-14(10-17-15)18-20-19-16/h1-9H,10H2,(H,18,19,20) |
| InChIKey | QNQHIWFLURTUTI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine?
The IUPAC name of 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine (CID 3060450) is 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine.
What is the SMILES notation for 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine?
The canonical SMILES for 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine is c1ccc(C2=NCc3n[nH]nc3-c3ccccc32)cc1.
What is the InChIKey of 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine?
The InChIKey is QNQHIWFLURTUTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4/c1-2-6-11(7-3-1)15-12-8-4-5-9-13(12)16-14(10-17-15)18-20-19-16/h1-9H,10H2,(H,18,19,20).
What are the key properties of 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine?
6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine has a molecular weight of 260.30 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-2,4-dihydrotriazolo[4,5-d][2]benzazepine is sourced from PubChem (CID 3060450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).