About (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate
(2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate (PubChem CID 30604501) has the molecular formula C18H15FN2O3S
and a molecular weight of 358.39 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
| PubChem CID | 30604501 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
| SMILES | Cc1noc(CSc2ccccc2C(=O)OCc2ccccc2F)n1 |
| InChI | InChI=1S/C18H15FN2O3S/c1-12-20-17(24-21-12)11-25-16-9-5-3-7-14(16)18(22)23-10-13-6-2-4-8-15(13)19/h2-9H,10-11H2,1H3 |
| InChIKey | YXSWLZNTBFFIDW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate?
The IUPAC name of (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate (CID 30604501) is (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate.
What is the SMILES notation for (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate?
The canonical SMILES for (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate is Cc1noc(CSc2ccccc2C(=O)OCc2ccccc2F)n1.
What is the InChIKey of (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate?
The InChIKey is YXSWLZNTBFFIDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O3S/c1-12-20-17(24-21-12)11-25-16-9-5-3-7-14(16)18(22)23-10-13-6-2-4-8-15(13)19/h2-9H,10-11H2,1H3.
What are the key properties of (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate?
(2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate has a molecular weight of 358.39 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate is sourced from PubChem (CID 30604501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).