About 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione
1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione (PubChem CID 3060453) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| PubChem CID | 3060453 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione |
| SMILES | CCc1csc(N2CC(=O)NC2=O)n1 |
| InChI | InChI=1S/C8H9N3O2S/c1-2-5-4-14-8(9-5)11-3-6(12)10-7(11)13/h4H,2-3H2,1H3,(H,10,12,13) |
| InChIKey | NXCPVRJFYMCGMY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The IUPAC name of 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione (CID 3060453) is 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione.
What is the SMILES notation for 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The canonical SMILES for 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione is CCc1csc(N2CC(=O)NC2=O)n1.
What is the InChIKey of 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
The InChIKey is NXCPVRJFYMCGMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c1-2-5-4-14-8(9-5)11-3-6(12)10-7(11)13/h4H,2-3H2,1H3,(H,10,12,13).
What are the key properties of 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione?
1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione has a molecular weight of 211.25 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-1,3-thiazol-2-yl)imidazolidine-2,4-dione is sourced from PubChem (CID 3060453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).