C19H17FN2O4S — CID 30604540
2-(4-fluorophenoxy)ethyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate (PubChem CID 30604540) has the molecular formula C19H17FN2O4S and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 30604540 |
| Molecular Formula | C19H17FN2O4S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 2-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]benzoate |
| SMILES | Cc1noc(CSc2ccccc2C(=O)OCCOc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H17FN2O4S/c1-13-21-18(26-22-13)12-27-17-5-3-2-4-16(17)19(23)25-11-10-24-15-8-6-14(20)7-9-15/h2-9H,10-12H2,1H3 |
| InChIKey | ZKYZYNKTQDYERS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|