About 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide
3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide (PubChem CID 3060488) has the molecular formula C20H26BrF2NO
and a molecular weight of 414.33 g/mol. Its IUPAC name is 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide.
Molecular Properties
| Compound Name | 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide |
| PubChem CID | 3060488 |
| Molecular Formula | C20H26BrF2NO |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide |
| SMILES | Br.CCN(CC)CC(C)C(O)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H25F2NO.BrH/c1-4-23(5-2)14-15(3)20(24,16-8-6-10-18(21)12-16)17-9-7-11-19(22)13-17;/h6-13,15,24H,4-5,14H2,1-3H3;1H |
| InChIKey | GTIQVZQLHDCGOH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide?
The IUPAC name of 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide (CID 3060488) is 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide.
What is the SMILES notation for 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide?
The canonical SMILES for 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide is Br.CCN(CC)CC(C)C(O)(c1cccc(F)c1)c1cccc(F)c1.
What is the InChIKey of 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide?
The InChIKey is GTIQVZQLHDCGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25F2NO.BrH/c1-4-23(5-2)14-15(3)20(24,16-8-6-10-18(21)12-16)17-9-7-11-19(22)13-17;/h6-13,15,24H,4-5,14H2,1-3H3;1H.
What are the key properties of 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide?
3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide has a molecular weight of 414.33 g/mol, XLogP of 4.76, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)-1,1-bis(3-fluorophenyl)-2-methylpropan-1-ol;hydrobromide is sourced from PubChem (CID 3060488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).