C20H30N2O5 — CID 3060502
1-hexyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-2,3-dione (PubChem CID 3060502) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-hexyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-hexyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 3060502 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-hexyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-2,3-dione |
| SMILES | CCCCCCN1CCN(Cc2ccc(OC)c(OC)c2OC)C(=O)C1=O |
| InChI | InChI=1S/C20H30N2O5/c1-5-6-7-8-11-21-12-13-22(20(24)19(21)23)14-15-9-10-16(25-2)18(27-4)17(15)26-3/h9-10H,5-8,11-14H2,1-4H3 |
| InChIKey | AMQLGAXQVACRLS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|