About 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole
3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 3060514) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
Analyze 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The IUPAC name of 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (CID 3060514) is 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
What is the SMILES notation for 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The canonical SMILES for 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is c1ccc(-c2nnc3n2CCC3)cc1.
What is the InChIKey of 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The InChIKey is KXOTZBRROFDUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-2-5-9(6-3-1)11-13-12-10-7-4-8-14(10)11/h1-3,5-6H,4,7-8H2.
What are the key properties of 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole has a molecular weight of 185.23 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is sourced from PubChem (CID 3060514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).