About 2-carbamoyloxypropyl carbamate
2-carbamoyloxypropyl carbamate (PubChem CID 3060523) has the molecular formula C5H10N2O4
and a molecular weight of 162.15 g/mol. Its IUPAC name is 2-carbamoyloxypropyl carbamate.
Molecular Properties
| Compound Name | 2-carbamoyloxypropyl carbamate |
| PubChem CID | 3060523 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 2-carbamoyloxypropyl carbamate |
| SMILES | CC(COC(N)=O)OC(N)=O |
| InChI | InChI=1S/C5H10N2O4/c1-3(11-5(7)9)2-10-4(6)8/h3H,2H2,1H3,(H2,6,8)(H2,7,9) |
| InChIKey | JPXZMWMLOYASFU-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-carbamoyloxypropyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoyloxypropyl carbamate?
The IUPAC name of 2-carbamoyloxypropyl carbamate (CID 3060523) is 2-carbamoyloxypropyl carbamate.
What is the SMILES notation for 2-carbamoyloxypropyl carbamate?
The canonical SMILES for 2-carbamoyloxypropyl carbamate is CC(COC(N)=O)OC(N)=O.
What is the InChIKey of 2-carbamoyloxypropyl carbamate?
The InChIKey is JPXZMWMLOYASFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O4/c1-3(11-5(7)9)2-10-4(6)8/h3H,2H2,1H3,(H2,6,8)(H2,7,9).
What are the key properties of 2-carbamoyloxypropyl carbamate?
2-carbamoyloxypropyl carbamate has a molecular weight of 162.15 g/mol, XLogP of -0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyloxypropyl carbamate is sourced from PubChem (CID 3060523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).