About (1-ethylpiperidin-4-yl) 4-aminobenzoate
(1-ethylpiperidin-4-yl) 4-aminobenzoate (PubChem CID 3060683) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is (1-ethylpiperidin-4-yl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (1-ethylpiperidin-4-yl) 4-aminobenzoate |
| PubChem CID | 3060683 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (1-ethylpiperidin-4-yl) 4-aminobenzoate |
| SMILES | CCN1CCC(OC(=O)c2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-2-16-9-7-13(8-10-16)18-14(17)11-3-5-12(15)6-4-11/h3-6,13H,2,7-10,15H2,1H3 |
| InChIKey | VMCHTHYDYKAPMS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylpiperidin-4-yl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylpiperidin-4-yl) 4-aminobenzoate?
The IUPAC name of (1-ethylpiperidin-4-yl) 4-aminobenzoate (CID 3060683) is (1-ethylpiperidin-4-yl) 4-aminobenzoate.
What is the SMILES notation for (1-ethylpiperidin-4-yl) 4-aminobenzoate?
The canonical SMILES for (1-ethylpiperidin-4-yl) 4-aminobenzoate is CCN1CCC(OC(=O)c2ccc(N)cc2)CC1.
What is the InChIKey of (1-ethylpiperidin-4-yl) 4-aminobenzoate?
The InChIKey is VMCHTHYDYKAPMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-2-16-9-7-13(8-10-16)18-14(17)11-3-5-12(15)6-4-11/h3-6,13H,2,7-10,15H2,1H3.
What are the key properties of (1-ethylpiperidin-4-yl) 4-aminobenzoate?
(1-ethylpiperidin-4-yl) 4-aminobenzoate has a molecular weight of 248.33 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylpiperidin-4-yl) 4-aminobenzoate is sourced from PubChem (CID 3060683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).