C8H17Cl2N2O2P — CID 3060706
N,N-bis(2-chloroethyl)-4-ethyl-2-oxo-1,3,2lambda5-oxazaphospholidin-2-amine (PubChem CID 3060706) has the molecular formula C8H17Cl2N2O2P and a molecular weight of 275.12 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-4-ethyl-2-oxo-1,3,2lambda5-oxazaphospholidin-2-amine.
| Compound Name | N,N-bis(2-chloroethyl)-4-ethyl-2-oxo-1,3,2lambda5-oxazaphospholidin-2-amine |
|---|---|
| PubChem CID | 3060706 |
| Molecular Formula | C8H17Cl2N2O2P |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N,N-bis(2-chloroethyl)-4-ethyl-2-oxo-1,3,2lambda5-oxazaphospholidin-2-amine |
| SMILES | CCC1COP(=O)(N(CCCl)CCCl)N1 |
| InChI | InChI=1S/C8H17Cl2N2O2P/c1-2-8-7-14-15(13,11-8)12(5-3-9)6-4-10/h8H,2-7H2,1H3,(H,11,13) |
| InChIKey | DREOKUIEHRVKQO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|