C25H33Cl2NO — CID 3060732
4-tert-butyl-1-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]piperidin-4-ol;hydrochloride (PubChem CID 3060732) has the molecular formula C25H33Cl2NO and a molecular weight of 434.45 g/mol. Its IUPAC name is 4-tert-butyl-1-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]piperidin-4-ol;hydrochloride.
| Compound Name | 4-tert-butyl-1-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]piperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 3060732 |
| Molecular Formula | C25H33Cl2NO |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-tert-butyl-1-[(6-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methyl]piperidin-4-ol;hydrochloride |
| SMILES | CC(C)(C)C1(O)CCN(CC2c3ccccc3CCc3cc(Cl)ccc32)CC1.Cl |
| InChI | InChI=1S/C25H32ClNO.ClH/c1-24(2,3)25(28)12-14-27(15-13-25)17-23-21-7-5-4-6-18(21)8-9-19-16-20(26)10-11-22(19)23;/h4-7,10-11,16,23,28H,8-9,12-15,17H2,1-3H3;1H |
| InChIKey | YDGKDSADZLCGDB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |