About 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride
3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride (PubChem CID 3060770) has the molecular formula C15H19ClN2OS
and a molecular weight of 310.85 g/mol. Its IUPAC name is 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride.
Molecular Properties
| Compound Name | 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride |
| PubChem CID | 3060770 |
| Molecular Formula | C15H19ClN2OS |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride |
| SMILES | O=C1NC2C[S+]3CCCC3C2N1Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C15H18N2OS.ClH/c18-15-16-12-10-19-8-4-7-13(19)14(12)17(15)9-11-5-2-1-3-6-11;/h1-3,5-6,12-14H,4,7-10H2;1H |
| InChIKey | FWRJBZDOPYILJD-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride?
The IUPAC name of 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride (CID 3060770) is 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride.
What is the SMILES notation for 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride?
The canonical SMILES for 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride is O=C1NC2C[S+]3CCCC3C2N1Cc1ccccc1.[Cl-].
What is the InChIKey of 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride?
The InChIKey is FWRJBZDOPYILJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2OS.ClH/c18-15-16-12-10-19-8-4-7-13(19)14(12)17(15)9-11-5-2-1-3-6-11;/h1-3,5-6,12-14H,4,7-10H2;1H.
What are the key properties of 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride?
3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride has a molecular weight of 310.85 g/mol, XLogP of -1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-8-thionia-3,5-diazatricyclo[6.3.0.02,6]undecan-4-one chloride is sourced from PubChem (CID 3060770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).