C21H25Cl2N3O — CID 3060895
1,3-bis(2-chloro-6-methylphenyl)-1-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 3060895) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 1,3-bis(2-chloro-6-methylphenyl)-1-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1,3-bis(2-chloro-6-methylphenyl)-1-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 3060895 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1,3-bis(2-chloro-6-methylphenyl)-1-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | Cc1cccc(Cl)c1NC(=O)N(CCN1CCCC1)c1c(C)cccc1Cl |
| InChI | InChI=1S/C21H25Cl2N3O/c1-15-7-5-9-17(22)19(15)24-21(27)26(14-13-25-11-3-4-12-25)20-16(2)8-6-10-18(20)23/h5-10H,3-4,11-14H2,1-2H3,(H,24,27) |
| InChIKey | VXMTWLMAHHEEAY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |