C11H13NO — CID 3061046
2-(4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethanol (PubChem CID 3061046) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethanol.
| Compound Name | 2-(4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethanol |
|---|---|
| PubChem CID | 3061046 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl)ethanol |
| SMILES | OCCn1cc2c(c1)C1C=CC2C1 |
| InChI | InChI=1S/C11H13NO/c13-4-3-12-6-10-8-1-2-9(5-8)11(10)7-12/h1-2,6-9,13H,3-5H2 |
| InChIKey | ZNEBRECBLUONJO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|