C16H15N3O — CID 3061059
5-(1,2-diphenylethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 3061059) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 5-(1,2-diphenylethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1,2-diphenylethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 3061059 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-(1,2-diphenylethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(C(Cc2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C16H15N3O/c17-16-19-18-15(20-16)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H2,17,19) |
| InChIKey | XDGUDFGGYHWZAH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |