C25H26N2O4 — CID 3061195
4-methyl-9-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-8,9-dihydropyrano[2,3-f]chromene-2,10-dione (PubChem CID 3061195) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-methyl-9-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-8,9-dihydropyrano[2,3-f]chromene-2,10-dione.
| Compound Name | 4-methyl-9-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-8,9-dihydropyrano[2,3-f]chromene-2,10-dione |
|---|---|
| PubChem CID | 3061195 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-methyl-9-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-8,9-dihydropyrano[2,3-f]chromene-2,10-dione |
| SMILES | Cc1ccc(N2CCN(CC3COc4ccc5c(C)cc(=O)oc5c4C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-16-3-5-19(6-4-16)27-11-9-26(10-12-27)14-18-15-30-21-8-7-20-17(2)13-22(28)31-25(20)23(21)24(18)29/h3-8,13,18H,9-12,14-15H2,1-2H3 |
| InChIKey | NOIQBSPHPSOASI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|