About 1-methyl-3-pentylurea
1-methyl-3-pentylurea (PubChem CID 3061203) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-methyl-3-pentylurea.
Molecular Properties
| Compound Name | 1-methyl-3-pentylurea |
| PubChem CID | 3061203 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1-methyl-3-pentylurea |
| SMILES | CCCCCNC(=O)NC |
| InChI | InChI=1S/C7H16N2O/c1-3-4-5-6-9-7(10)8-2/h3-6H2,1-2H3,(H2,8,9,10) |
| InChIKey | GMALRFFLCMWBEZ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-pentylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-pentylurea?
The IUPAC name of 1-methyl-3-pentylurea (CID 3061203) is 1-methyl-3-pentylurea.
What is the SMILES notation for 1-methyl-3-pentylurea?
The canonical SMILES for 1-methyl-3-pentylurea is CCCCCNC(=O)NC.
What is the InChIKey of 1-methyl-3-pentylurea?
The InChIKey is GMALRFFLCMWBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-3-4-5-6-9-7(10)8-2/h3-6H2,1-2H3,(H2,8,9,10).
What are the key properties of 1-methyl-3-pentylurea?
1-methyl-3-pentylurea has a molecular weight of 144.22 g/mol, XLogP of 1.11, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-pentylurea is sourced from PubChem (CID 3061203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).