C16H19N5O4 — CID 3061324
8-anilino-7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 3061324) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 8-anilino-7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-anilino-7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3061324 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 8-anilino-7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Nc3ccccc3)n2CC(O)CO)n(C)c1=O |
| InChI | InChI=1S/C16H19N5O4/c1-19-13-12(14(24)20(2)16(19)25)21(8-11(23)9-22)15(18-13)17-10-6-4-3-5-7-10/h3-7,11,22-23H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | ZXTVYYARXMAMBL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |