About N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide
N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide (PubChem CID 3061335) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide.
Molecular Properties
| Compound Name | N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide |
| PubChem CID | 3061335 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide |
| SMILES | CC(=O)NNC1=Nc2ccccc2SC1 |
| InChI | InChI=1S/C10H11N3OS/c1-7(14)12-13-10-6-15-9-5-3-2-4-8(9)11-10/h2-5H,6H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | DOOIQFCUDWWTKB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide?
The IUPAC name of N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide (CID 3061335) is N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide.
What is the SMILES notation for N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide?
The canonical SMILES for N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide is CC(=O)NNC1=Nc2ccccc2SC1.
What is the InChIKey of N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide?
The InChIKey is DOOIQFCUDWWTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-7(14)12-13-10-6-15-9-5-3-2-4-8(9)11-10/h2-5H,6H2,1H3,(H,11,13)(H,12,14).
What are the key properties of N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide?
N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide has a molecular weight of 221.28 g/mol, XLogP of 1.46, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2H-1,4-benzothiazin-3-yl)acetohydrazide is sourced from PubChem (CID 3061335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).