About 2-propan-2-yl-1,3-thiazinane;hydrochloride
2-propan-2-yl-1,3-thiazinane;hydrochloride (PubChem CID 3061403) has the molecular formula C7H16ClNS
and a molecular weight of 181.73 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-thiazinane;hydrochloride.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,3-thiazinane;hydrochloride |
| PubChem CID | 3061403 |
| Molecular Formula | C7H16ClNS |
| Molecular Weight | 181.73 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-propan-2-yl-1,3-thiazinane;hydrochloride |
| SMILES | CC(C)C1NCCCS1.Cl |
| InChI | InChI=1S/C7H15NS.ClH/c1-6(2)7-8-4-3-5-9-7;/h6-8H,3-5H2,1-2H3;1H |
| InChIKey | LPZXVEYJFMQVPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-1,3-thiazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,3-thiazinane;hydrochloride?
The IUPAC name of 2-propan-2-yl-1,3-thiazinane;hydrochloride (CID 3061403) is 2-propan-2-yl-1,3-thiazinane;hydrochloride.
What is the SMILES notation for 2-propan-2-yl-1,3-thiazinane;hydrochloride?
The canonical SMILES for 2-propan-2-yl-1,3-thiazinane;hydrochloride is CC(C)C1NCCCS1.Cl.
What is the InChIKey of 2-propan-2-yl-1,3-thiazinane;hydrochloride?
The InChIKey is LPZXVEYJFMQVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS.ClH/c1-6(2)7-8-4-3-5-9-7;/h6-8H,3-5H2,1-2H3;1H.
What are the key properties of 2-propan-2-yl-1,3-thiazinane;hydrochloride?
2-propan-2-yl-1,3-thiazinane;hydrochloride has a molecular weight of 181.73 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,3-thiazinane;hydrochloride is sourced from PubChem (CID 3061403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).