About 2-pentan-2-yl-1,3-thiazinane;hydrochloride
2-pentan-2-yl-1,3-thiazinane;hydrochloride (PubChem CID 3061407) has the molecular formula C9H20ClNS
and a molecular weight of 209.79 g/mol. Its IUPAC name is 2-pentan-2-yl-1,3-thiazinane;hydrochloride.
Molecular Properties
| Compound Name | 2-pentan-2-yl-1,3-thiazinane;hydrochloride |
| PubChem CID | 3061407 |
| Molecular Formula | C9H20ClNS |
| Molecular Weight | 209.79 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-pentan-2-yl-1,3-thiazinane;hydrochloride |
| SMILES | CCCC(C)C1NCCCS1.Cl |
| InChI | InChI=1S/C9H19NS.ClH/c1-3-5-8(2)9-10-6-4-7-11-9;/h8-10H,3-7H2,1-2H3;1H |
| InChIKey | SKPYIOWWWIOGGT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pentan-2-yl-1,3-thiazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-2-yl-1,3-thiazinane;hydrochloride?
The IUPAC name of 2-pentan-2-yl-1,3-thiazinane;hydrochloride (CID 3061407) is 2-pentan-2-yl-1,3-thiazinane;hydrochloride.
What is the SMILES notation for 2-pentan-2-yl-1,3-thiazinane;hydrochloride?
The canonical SMILES for 2-pentan-2-yl-1,3-thiazinane;hydrochloride is CCCC(C)C1NCCCS1.Cl.
What is the InChIKey of 2-pentan-2-yl-1,3-thiazinane;hydrochloride?
The InChIKey is SKPYIOWWWIOGGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS.ClH/c1-3-5-8(2)9-10-6-4-7-11-9;/h8-10H,3-7H2,1-2H3;1H.
What are the key properties of 2-pentan-2-yl-1,3-thiazinane;hydrochloride?
2-pentan-2-yl-1,3-thiazinane;hydrochloride has a molecular weight of 209.79 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-2-yl-1,3-thiazinane;hydrochloride is sourced from PubChem (CID 3061407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).