About 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride
2-(2-methylphenyl)-1,3-thiazinane;hydrochloride (PubChem CID 3061417) has the molecular formula C11H16ClNS
and a molecular weight of 229.78 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride |
| PubChem CID | 3061417 |
| Molecular Formula | C11H16ClNS |
| Molecular Weight | 229.78 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride |
| SMILES | Cc1ccccc1C1NCCCS1.Cl |
| InChI | InChI=1S/C11H15NS.ClH/c1-9-5-2-3-6-10(9)11-12-7-4-8-13-11;/h2-3,5-6,11-12H,4,7-8H2,1H3;1H |
| InChIKey | BASKGMVJSACIBA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride?
The IUPAC name of 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride (CID 3061417) is 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride.
What is the SMILES notation for 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride?
The canonical SMILES for 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride is Cc1ccccc1C1NCCCS1.Cl.
What is the InChIKey of 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride?
The InChIKey is BASKGMVJSACIBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS.ClH/c1-9-5-2-3-6-10(9)11-12-7-4-8-13-11;/h2-3,5-6,11-12H,4,7-8H2,1H3;1H.
What are the key properties of 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride?
2-(2-methylphenyl)-1,3-thiazinane;hydrochloride has a molecular weight of 229.78 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)-1,3-thiazinane;hydrochloride is sourced from PubChem (CID 3061417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).