About N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide
N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide (PubChem CID 3061435) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide |
| PubChem CID | 3061435 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide |
| SMILES | CN(C=O)c1ccc(C2OC(C)(C)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-19(2)20-17(14-7-5-4-6-8-14)18(23-19)15-9-11-16(12-10-15)21(3)13-22/h4-13,18H,1-3H3 |
| InChIKey | AIPTVGGEVILGAD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide?
The IUPAC name of N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide (CID 3061435) is N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide.
What is the SMILES notation for N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide?
The canonical SMILES for N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide is CN(C=O)c1ccc(C2OC(C)(C)N=C2c2ccccc2)cc1.
What is the InChIKey of N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide?
The InChIKey is AIPTVGGEVILGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-19(2)20-17(14-7-5-4-6-8-14)18(23-19)15-9-11-16(12-10-15)21(3)13-22/h4-13,18H,1-3H3.
What are the key properties of N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide?
N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide has a molecular weight of 308.38 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)phenyl]-N-methylformamide is sourced from PubChem (CID 3061435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).