C10H9NO4S — CID 3061687
5-[(3,4-dihydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 3061687) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is 5-[(3,4-dihydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(3,4-dihydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3061687 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-[(3,4-dihydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(O)c(O)c2)S1 |
| InChI | InChI=1S/C10H9NO4S/c12-6-2-1-5(3-7(6)13)4-8-9(14)11-10(15)16-8/h1-3,8,12-13H,4H2,(H,11,14,15) |
| InChIKey | BDVGWQVSMPATBP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|