C17H22ClN5 — CID 30617981
1-(5-chloro-2-methylphenyl)-5-(1-pyrrolidin-1-ylcyclopentyl)tetrazole (PubChem CID 30617981) has the molecular formula C17H22ClN5 and a molecular weight of 331.85 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-5-(1-pyrrolidin-1-ylcyclopentyl)tetrazole.
| Compound Name | 1-(5-chloro-2-methylphenyl)-5-(1-pyrrolidin-1-ylcyclopentyl)tetrazole |
|---|---|
| PubChem CID | 30617981 |
| Molecular Formula | C17H22ClN5 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-5-(1-pyrrolidin-1-ylcyclopentyl)tetrazole |
| SMILES | Cc1ccc(Cl)cc1-n1nnnc1C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C17H22ClN5/c1-13-6-7-14(18)12-15(13)23-16(19-20-21-23)17(8-2-3-9-17)22-10-4-5-11-22/h6-7,12H,2-5,8-11H2,1H3 |
| InChIKey | DHNVWZFYVSWOPL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |