About 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide
2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide (PubChem CID 3061841) has the molecular formula C23H30INO
and a molecular weight of 463.40 g/mol. Its IUPAC name is 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide.
Molecular Properties
| Compound Name | 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide |
| PubChem CID | 3061841 |
| Molecular Formula | C23H30INO |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide |
| SMILES | C=CC[N+]1(C)CCCC1C(O)(Cc1ccccc1)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C23H30NO.HI/c1-3-16-24(2)17-10-15-22(24)23(25,18-20-11-6-4-7-12-20)19-21-13-8-5-9-14-21;/h3-9,11-14,22,25H,1,10,15-19H2,2H3;1H/q+1;/p-1 |
| InChIKey | ACYQILLUENXBNM-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide?
The IUPAC name of 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide (CID 3061841) is 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide.
What is the SMILES notation for 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide?
The canonical SMILES for 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide is C=CC[N+]1(C)CCCC1C(O)(Cc1ccccc1)Cc1ccccc1.[I-].
What is the InChIKey of 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide?
The InChIKey is ACYQILLUENXBNM-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H30NO.HI/c1-3-16-24(2)17-10-15-22(24)23(25,18-20-11-6-4-7-12-20)19-21-13-8-5-9-14-21;/h3-9,11-14,22,25H,1,10,15-19H2,2H3;1H/q+1;/p-1.
What are the key properties of 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide?
2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide has a molecular weight of 463.40 g/mol, XLogP of 1.00, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-1-prop-2-enylpyrrolidin-1-ium-2-yl)-1,3-diphenylpropan-2-ol iodide is sourced from PubChem (CID 3061841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).