About Epinastine hydrobromide
Epinastine hydrobromide (PubChem CID 3061907) has the molecular formula C16H16BrN3
and a molecular weight of 330.22 g/mol. Its IUPAC name is 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrobromide.
Molecular Properties
| Compound Name | Epinastine hydrobromide |
| PubChem CID | 3061907 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrobromide |
| SMILES | C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N.Br |
| InChI | InChI=1S/C16H15N3.BrH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H |
| InChIKey | ADPMHRDERZTFIN-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 41.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | 378 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Epinastine hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Epinastine hydrobromide?
The IUPAC name of Epinastine hydrobromide (CID 3061907) is 2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,7,9,11,14,16-heptaen-3-amine;hydrobromide.
What is the SMILES notation for Epinastine hydrobromide?
The canonical SMILES for Epinastine hydrobromide is C1C2C3=CC=CC=C3CC4=CC=CC=C4N2C(=N1)N.Br.
What is the InChIKey of Epinastine hydrobromide?
The InChIKey is ADPMHRDERZTFIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3.BrH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H.
What are the key properties of Epinastine hydrobromide?
Epinastine hydrobromide has a molecular weight of 330.22 g/mol, XLogP of not available, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Epinastine hydrobromide is sourced from PubChem (CID 3061907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).