C18H29N5O5S — CID 30620116
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide (PubChem CID 30620116) has the molecular formula C18H29N5O5S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30620116 |
| Molecular Formula | C18H29N5O5S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN([C@@H]2CCS(=O)(=O)C2)CC1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H29N5O5S/c24-15(20-23-16(25)18(19-17(23)26)5-2-1-3-6-18)12-21-7-9-22(10-8-21)14-4-11-29(27,28)13-14/h14H,1-13H2,(H,19,26)(H,20,24)/t14-/m1/s1 |
| InChIKey | FYICEOKQSRATGQ-CQSZACIVSA-N |
| XLogP | -0.92 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|