C18H22ClNO3 — CID 30621148
(1R)-1-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine (PubChem CID 30621148) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is (1R)-1-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 30621148 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (1R)-1-(4-chlorophenyl)-N-[(2,4,5-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(OC)c(OC)cc1CN[C@H](C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO3/c1-12(13-5-7-15(19)8-6-13)20-11-14-9-17(22-3)18(23-4)10-16(14)21-2/h5-10,12,20H,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | RPYCPFOIXXUWJP-GFCCVEGCSA-N |
| XLogP | 4.22 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |