About 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride
1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride (PubChem CID 3062145) has the molecular formula C20H26ClFN2O3
and a molecular weight of 396.89 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride |
| PubChem CID | 3062145 |
| Molecular Formula | C20H26ClFN2O3 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride |
| SMILES | COc1cc(CN2CCN(c3ccccc3F)CC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C20H25FN2O3.ClH/c1-24-18-12-15(13-19(25-2)20(18)26-3)14-22-8-10-23(11-9-22)17-7-5-4-6-16(17)21;/h4-7,12-13H,8-11,14H2,1-3H3;1H |
| InChIKey | GFFQZPFWQJWGBK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride?
The IUPAC name of 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride (CID 3062145) is 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride.
What is the SMILES notation for 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride?
The canonical SMILES for 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride is COc1cc(CN2CCN(c3ccccc3F)CC2)cc(OC)c1OC.Cl.
What is the InChIKey of 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride?
The InChIKey is GFFQZPFWQJWGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O3.ClH/c1-24-18-12-15(13-19(25-2)20(18)26-3)14-22-8-10-23(11-9-22)17-7-5-4-6-16(17)21;/h4-7,12-13H,8-11,14H2,1-3H3;1H.
What are the key properties of 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride?
1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride has a molecular weight of 396.89 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;hydrochloride is sourced from PubChem (CID 3062145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).