About N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide
N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide (PubChem CID 3062172) has the molecular formula C20H16Cl2N2O2
and a molecular weight of 387.27 g/mol. Its IUPAC name is N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| PubChem CID | 3062172 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccc(Cl)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-12-11-18(25)19(20(26)23-16-7-3-14(21)4-8-16)13(2)24(12)17-9-5-15(22)6-10-17/h3-11H,1-2H3,(H,23,26) |
| InChIKey | HNMDDIZFSGFPPB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The IUPAC name of N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide (CID 3062172) is N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide.
What is the SMILES notation for N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The canonical SMILES for N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide is Cc1cc(=O)c(C(=O)Nc2ccc(Cl)cc2)c(C)n1-c1ccc(Cl)cc1.
What is the InChIKey of N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide?
The InChIKey is HNMDDIZFSGFPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl2N2O2/c1-12-11-18(25)19(20(26)23-16-7-3-14(21)4-8-16)13(2)24(12)17-9-5-15(22)6-10-17/h3-11H,1-2H3,(H,23,26).
What are the key properties of N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide?
N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide has a molecular weight of 387.27 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-bis(4-chlorophenyl)-2,6-dimethyl-4-oxopyridine-3-carboxamide is sourced from PubChem (CID 3062172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).