C11H16N6OS — CID 3062333
N-cyclopropyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide (PubChem CID 3062333) has the molecular formula C11H16N6OS and a molecular weight of 280.36 g/mol. Its IUPAC name is N-cyclopropyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide.
| Compound Name | N-cyclopropyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 3062333 |
| Molecular Formula | C11H16N6OS |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | N-cyclopropyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
| SMILES | NC(N)=Nc1nc2c(s1)CN(C(=O)NC1CC1)CC2 |
| InChI | InChI=1S/C11H16N6OS/c12-9(13)16-10-15-7-3-4-17(5-8(7)19-10)11(18)14-6-1-2-6/h6H,1-5H2,(H,14,18)(H4,12,13,15,16) |
| InChIKey | IDLFGBDIKSBCRO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|