C12H20N6OS — CID 3062337
N-butyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide (PubChem CID 3062337) has the molecular formula C12H20N6OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-butyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide.
| Compound Name | N-butyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 3062337 |
| Molecular Formula | C12H20N6OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-butyl-2-(diaminomethylideneamino)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
| SMILES | CCCCNC(=O)N1CCc2nc(N=C(N)N)sc2C1 |
| InChI | InChI=1S/C12H20N6OS/c1-2-3-5-15-12(19)18-6-4-8-9(7-18)20-11(16-8)17-10(13)14/h2-7H2,1H3,(H,15,19)(H4,13,14,16,17) |
| InChIKey | UJGSWLRDODLNIJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|