C13H13NO2 — CID 3062432
spiro[2,4-dihydro-1H-naphthalene-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 3062432) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is spiro[2,4-dihydro-1H-naphthalene-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | spiro[2,4-dihydro-1H-naphthalene-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 3062432 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | spiro[2,4-dihydro-1H-naphthalene-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1CC2(CCc3ccccc3C2)C(=O)N1 |
| InChI | InChI=1S/C13H13NO2/c15-11-8-13(12(16)14-11)6-5-9-3-1-2-4-10(9)7-13/h1-4H,5-8H2,(H,14,15,16) |
| InChIKey | PLEYVXJVPUTVOC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|