C14H23NO5S — CID 3062444
2-(tert-butylamino)-1-(3-methoxyphenyl)ethanone;methanesulfonic acid (PubChem CID 3062444) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(3-methoxyphenyl)ethanone;methanesulfonic acid.
| Compound Name | 2-(tert-butylamino)-1-(3-methoxyphenyl)ethanone;methanesulfonic acid |
|---|---|
| PubChem CID | 3062444 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-(tert-butylamino)-1-(3-methoxyphenyl)ethanone;methanesulfonic acid |
| SMILES | COc1cccc(C(=O)CNC(C)(C)C)c1.CS(=O)(=O)O |
| InChI | InChI=1S/C13H19NO2.CH4O3S/c1-13(2,3)14-9-12(15)10-6-5-7-11(8-10)16-4;1-5(2,3)4/h5-8,14H,9H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | DGABZOOBXRYOTQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|