About 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine
8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine (PubChem CID 3062492) has the molecular formula C11H8ClN3
and a molecular weight of 217.66 g/mol. Its IUPAC name is 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine |
| PubChem CID | 3062492 |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine |
| SMILES | Clc1ccc2c(c1)Cn1ccnc1C=N2 |
| InChI | InChI=1S/C11H8ClN3/c12-9-1-2-10-8(5-9)7-15-4-3-13-11(15)6-14-10/h1-6H,7H2 |
| InChIKey | OUSSAKHVCAAATO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine?
The IUPAC name of 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine (CID 3062492) is 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine.
What is the SMILES notation for 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine?
The canonical SMILES for 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine is Clc1ccc2c(c1)Cn1ccnc1C=N2.
What is the InChIKey of 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine?
The InChIKey is OUSSAKHVCAAATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3/c12-9-1-2-10-8(5-9)7-15-4-3-13-11(15)6-14-10/h1-6H,7H2.
What are the key properties of 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine?
8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine has a molecular weight of 217.66 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-10H-imidazo[2,1-c][1,4]benzodiazepine is sourced from PubChem (CID 3062492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).