C15H21N — CID 3062570
2,3,4,5a,9,10,10a,10b,11,11a-decahydro-1H-indeno[1,2-b]indolizine (PubChem CID 3062570) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2,3,4,5a,9,10,10a,10b,11,11a-decahydro-1H-indeno[1,2-b]indolizine.
| Compound Name | 2,3,4,5a,9,10,10a,10b,11,11a-decahydro-1H-indeno[1,2-b]indolizine |
|---|---|
| PubChem CID | 3062570 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2,3,4,5a,9,10,10a,10b,11,11a-decahydro-1H-indeno[1,2-b]indolizine |
| SMILES | C1=CC2=CC3C(CC4CCCCN43)C2CC1 |
| InChI | InChI=1S/C15H21N/c1-2-7-13-11(5-1)9-15-14(13)10-12-6-3-4-8-16(12)15/h1,5,9,12-15H,2-4,6-8,10H2 |
| InChIKey | DKCKLZIITLGDHD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |