C17H26N4 — CID 3062571
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1H-indazol-3-amine (PubChem CID 3062571) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1H-indazol-3-amine.
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 3062571 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-1H-indazol-3-amine |
| SMILES | CC1CCCC(C)N1CCCNc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C17H26N4/c1-13-7-5-8-14(2)21(13)12-6-11-18-17-15-9-3-4-10-16(15)19-20-17/h3-4,9-10,13-14H,5-8,11-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | WGOFCCGLYQIQSC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|