C19H21N5O2 — CID 3062798
N,N-diethyl-2-(10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-14-yl)ethanamine (PubChem CID 3062798) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N,N-diethyl-2-(10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-14-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-14-yl)ethanamine |
|---|---|
| PubChem CID | 3062798 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N,N-diethyl-2-(10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-14-yl)ethanamine |
| SMILES | CCN(CC)CCn1nc2c3c(c([N+](=O)[O-])ccc31)Nc1ccccc1-2 |
| InChI | InChI=1S/C19H21N5O2/c1-3-22(4-2)11-12-23-15-9-10-16(24(25)26)19-17(15)18(21-23)13-7-5-6-8-14(13)20-19/h5-10,20H,3-4,11-12H2,1-2H3 |
| InChIKey | VALPGWNRUXIMBM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|