C19H22N2O2 — CID 3062809
4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)-N,N-dimethylbenzeneamine oxide (PubChem CID 3062809) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)-N,N-dimethylbenzeneamine oxide.
| Compound Name | 4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)-N,N-dimethylbenzeneamine oxide |
|---|---|
| PubChem CID | 3062809 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-(2,2-dimethyl-4-phenyl-5H-1,3-oxazol-5-yl)-N,N-dimethylbenzeneamine oxide |
| SMILES | CC1(C)N=C(c2ccccc2)C(c2ccc([N+](C)(C)[O-])cc2)O1 |
| InChI | InChI=1S/C19H22N2O2/c1-19(2)20-17(14-8-6-5-7-9-14)18(23-19)15-10-12-16(13-11-15)21(3,4)22/h5-13,18H,1-4H3 |
| InChIKey | UGKSQFYALNFOSH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|